C29H29N3O2S — CID 108748009
N-[6-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]anilino]-6-oxohexyl]benzamide (PubChem CID 108748009) has the molecular formula C29H29N3O2S and a molecular weight of 483.64 g/mol. Its IUPAC name is N-[6-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]anilino]-6-oxohexyl]benzamide.
| Compound Name | N-[6-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]anilino]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 108748009 |
| Molecular Formula | C29H29N3O2S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | N-[6-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]anilino]-6-oxohexyl]benzamide |
| SMILES | Cc1ccccc1-c1nc(-c2ccc(NC(=O)CCCCCNC(=O)c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C29H29N3O2S/c1-21-10-7-8-13-25(21)29-32-26(20-35-29)22-15-17-24(18-16-22)31-27(33)14-6-3-9-19-30-28(34)23-11-4-2-5-12-23/h2,4-5,7-8,10-13,15-18,20H,3,6,9,14,19H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | NLDPAYUCCOLJGT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|