C28H30N2OS — CID 108770065
2-(1-adamantyl)-N-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]phenyl]acetamide (PubChem CID 108770065) has the molecular formula C28H30N2OS and a molecular weight of 442.63 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]phenyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108770065 |
| Molecular Formula | C28H30N2OS |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-(1-adamantyl)-N-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]phenyl]acetamide |
| SMILES | Cc1ccccc1-c1nc(-c2ccc(NC(=O)CC34CC5CC(CC(C5)C3)C4)cc2)cs1 |
| InChI | InChI=1S/C28H30N2OS/c1-18-4-2-3-5-24(18)27-30-25(17-32-27)22-6-8-23(9-7-22)29-26(31)16-28-13-19-10-20(14-28)12-21(11-19)15-28/h2-9,17,19-21H,10-16H2,1H3,(H,29,31) |
| InChIKey | QXEIEKHBAADXMZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |