C25H27N3O — CID 122284090
2-(1-adamantyl)-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide (PubChem CID 122284090) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 122284090 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-(1-adamantyl)-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1ccc(-c2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H27N3O/c29-24(15-25-12-17-9-18(13-25)11-19(10-17)14-25)26-21-6-4-20(5-7-21)22-16-28-8-2-1-3-23(28)27-22/h1-8,16-19H,9-15H2,(H,26,29) |
| InChIKey | GSEWYYMUFBTUTG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |