C30H35N5O — CID 122297738
2-(1-adamantyl)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 122297738) has the molecular formula C30H35N5O and a molecular weight of 481.64 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 122297738 |
| Molecular Formula | C30H35N5O |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 2-(1-adamantyl)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | Cc1ccc(Nc2cc(Nc3ccc(NC(=O)CC45CC6CC(CC(C6)C4)C5)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C30H35N5O/c1-19-3-5-24(6-4-19)33-27-14-28(32-20(2)31-27)34-25-7-9-26(10-8-25)35-29(36)18-30-15-21-11-22(16-30)13-23(12-21)17-30/h3-10,14,21-23H,11-13,15-18H2,1-2H3,(H,35,36)(H2,31,32,33,34) |
| InChIKey | XFDBTJTVMQXXJQ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |