C26H35N5O — CID 122296737
N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]adamantane-1-carboxamide (PubChem CID 122296737) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 122296737 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]adamantane-1-carboxamide |
| SMILES | CCN(CC)c1cc(Nc2ccc(NC(=O)C34CC5CC(CC(C5)C3)C4)cc2)nc(C)n1 |
| InChI | InChI=1S/C26H35N5O/c1-4-31(5-2)24-13-23(27-17(3)28-24)29-21-6-8-22(9-7-21)30-25(32)26-14-18-10-19(15-26)12-20(11-18)16-26/h6-9,13,18-20H,4-5,10-12,14-16H2,1-3H3,(H,30,32)(H,27,28,29) |
| InChIKey | XOANSNCCIBFZKN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |