C14H16N4O3S — CID 87993044
[2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]ethylamino] carbamate (PubChem CID 87993044) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is [2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]ethylamino] carbamate.
| Compound Name | [2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]ethylamino] carbamate |
|---|---|
| PubChem CID | 87993044 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]ethylamino] carbamate |
| SMILES | CC(=O)Nc1nc(-c2ccc(CCNOC(N)=O)cc2)cs1 |
| InChI | InChI=1S/C14H16N4O3S/c1-9(19)17-14-18-12(8-22-14)11-4-2-10(3-5-11)6-7-16-21-13(15)20/h2-5,8,16H,6-7H2,1H3,(H2,15,20)(H,17,18,19) |
| InChIKey | AMADUUFPSMGGFE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|