C17H17Cl2N3O2S — CID 31933611
(1S)-N-[4-[4-(2-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 31933611) has the molecular formula C17H17Cl2N3O2S and a molecular weight of 398.32 g/mol. Its IUPAC name is (1S)-N-[4-[4-(2-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | (1S)-N-[4-[4-(2-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 31933611 |
| Molecular Formula | C17H17Cl2N3O2S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | (1S)-N-[4-[4-(2-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | CC(=O)NCCc1ccc(-c2csc(NC(=O)[C@@H]3CC3(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O2S/c1-10(23)20-7-6-11-2-4-12(5-3-11)14-9-25-16(21-14)22-15(24)13-8-17(13,18)19/h2-5,9,13H,6-8H2,1H3,(H,20,23)(H,21,22,24)/t13-/m0/s1 |
| InChIKey | KSTSUNDMJSKJPW-ZDUSSCGKSA-N |
| XLogP | 3.62 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|