C16H19N5O7S2 — CID 87760195
2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]sulfonylethyliminomethylcarbamic acid;carbamic acid (PubChem CID 87760195) has the molecular formula C16H19N5O7S2 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]sulfonylethyliminomethylcarbamic acid;carbamic acid.
| Compound Name | 2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]sulfonylethyliminomethylcarbamic acid;carbamic acid |
|---|---|
| PubChem CID | 87760195 |
| Molecular Formula | C16H19N5O7S2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]sulfonylethyliminomethylcarbamic acid;carbamic acid |
| SMILES | CC(=O)Nc1nc(-c2ccc(S(=O)(=O)CC/N=C/NC(=O)O)cc2)cs1.NC(=O)O |
| InChI | InChI=1S/C15H16N4O5S2.CH3NO2/c1-10(20)18-14-19-13(8-25-14)11-2-4-12(5-3-11)26(23,24)7-6-16-9-17-15(21)22;2-1(3)4/h2-5,8-9H,6-7H2,1H3,(H,16,17)(H,21,22)(H,18,19,20);2H2,(H,3,4) |
| InChIKey | FOYATAXAFRLVAZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 201.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|