C17H21N5O5S — CID 87597071
[[4-[3-(2-acetamido-1,3-thiazol-4-yl)propyl]anilino]-(carboxyamino)methyl]carbamic acid (PubChem CID 87597071) has the molecular formula C17H21N5O5S and a molecular weight of 407.45 g/mol. Its IUPAC name is [[4-[3-(2-acetamido-1,3-thiazol-4-yl)propyl]anilino]-(carboxyamino)methyl]carbamic acid.
| Compound Name | [[4-[3-(2-acetamido-1,3-thiazol-4-yl)propyl]anilino]-(carboxyamino)methyl]carbamic acid |
|---|---|
| PubChem CID | 87597071 |
| Molecular Formula | C17H21N5O5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [[4-[3-(2-acetamido-1,3-thiazol-4-yl)propyl]anilino]-(carboxyamino)methyl]carbamic acid |
| SMILES | CC(=O)Nc1nc(CCCc2ccc(NC(NC(=O)O)NC(=O)O)cc2)cs1 |
| InChI | InChI=1S/C17H21N5O5S/c1-10(23)18-15-20-13(9-28-15)4-2-3-11-5-7-12(8-6-11)19-14(21-16(24)25)22-17(26)27/h5-9,14,19,21-22H,2-4H2,1H3,(H,24,25)(H,26,27)(H,18,20,23) |
| InChIKey | GUIPCQXHSDTFSS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|