C13H18N2O3S — CID 80655533
4-[2-[[(Z)-2-methylpent-2-enoyl]amino]-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80655533) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-[2-[[(Z)-2-methylpent-2-enoyl]amino]-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-[[(Z)-2-methylpent-2-enoyl]amino]-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80655533 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-[2-[[(Z)-2-methylpent-2-enoyl]amino]-1,3-thiazol-4-yl]butanoic acid |
| SMILES | CC/C=C(/C)C(=O)Nc1nc(CCCC(=O)O)cs1 |
| InChI | InChI=1S/C13H18N2O3S/c1-3-5-9(2)12(18)15-13-14-10(8-19-13)6-4-7-11(16)17/h5,8H,3-4,6-7H2,1-2H3,(H,16,17)(H,14,15,18)/b9-5- |
| InChIKey | VLXPCPLVPQXVIU-UITAMQMPSA-N |
| XLogP | 2.85 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|