C10H12N2O3S — CID 115909600
2-[2-[[(Z)-2-methylbut-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 115909600) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-[2-[[(Z)-2-methylbut-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[[(Z)-2-methylbut-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 115909600 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2-[2-[[(Z)-2-methylbut-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | C/C=C(/C)C(=O)Nc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C10H12N2O3S/c1-3-6(2)9(15)12-10-11-7(5-16-10)4-8(13)14/h3,5H,4H2,1-2H3,(H,13,14)(H,11,12,15)/b6-3- |
| InChIKey | QXPCNPGACUFPBX-UTCJRWHESA-N |
| XLogP | 1.67 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|