C13H21N5O3S — CID 139707661
2-acetamidoethyl 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 139707661) has the molecular formula C13H21N5O3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-acetamidoethyl 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylate.
| Compound Name | 2-acetamidoethyl 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 139707661 |
| Molecular Formula | C13H21N5O3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-acetamidoethyl 2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCCC/N=C(\N)Nc1nc(C(=O)OCCNC(C)=O)cs1 |
| InChI | InChI=1S/C13H21N5O3S/c1-3-4-5-16-12(14)18-13-17-10(8-22-13)11(20)21-7-6-15-9(2)19/h8H,3-7H2,1-2H3,(H,15,19)(H3,14,16,17,18) |
| InChIKey | DIJMGTQVJLVEDW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|