C15H21N7OS — CID 67869925
[6-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-5-methyl-2-pyridinyl]urea (PubChem CID 67869925) has the molecular formula C15H21N7OS and a molecular weight of 347.45 g/mol. Its IUPAC name is [6-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-5-methyl-2-pyridinyl]urea.
| Compound Name | [6-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-5-methyl-2-pyridinyl]urea |
|---|---|
| PubChem CID | 67869925 |
| Molecular Formula | C15H21N7OS |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [6-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-5-methyl-2-pyridinyl]urea |
| SMILES | CCCC/N=C(\N)Nc1nc(-c2nc(NC(N)=O)ccc2C)cs1 |
| InChI | InChI=1S/C15H21N7OS/c1-3-4-7-18-13(16)22-15-19-10(8-24-15)12-9(2)5-6-11(20-12)21-14(17)23/h5-6,8H,3-4,7H2,1-2H3,(H3,16,18,19,22)(H3,17,20,21,23) |
| InChIKey | ZLMWJMSNGRVPAI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|