C11H10N2O3S2 — CID 3068160
ethyl 2-oxo-2-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]acetate (PubChem CID 3068160) has the molecular formula C11H10N2O3S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is ethyl 2-oxo-2-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]acetate.
| Compound Name | ethyl 2-oxo-2-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]acetate |
|---|---|
| PubChem CID | 3068160 |
| Molecular Formula | C11H10N2O3S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | ethyl 2-oxo-2-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]acetate |
| SMILES | CCOC(=O)C(=O)Nc1nc(-c2ccsc2)cs1 |
| InChI | InChI=1S/C11H10N2O3S2/c1-2-16-10(15)9(14)13-11-12-8(6-18-11)7-3-4-17-5-7/h3-6H,2H2,1H3,(H,12,13,14) |
| InChIKey | OUJAGNNEYZHZKK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|