C15H12F3N3O4S — CID 13177563
ethyl 2-oxo-2-[[4-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]-1,3-thiazol-2-yl]amino]acetate (PubChem CID 13177563) has the molecular formula C15H12F3N3O4S and a molecular weight of 387.34 g/mol. Its IUPAC name is ethyl 2-oxo-2-[[4-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]-1,3-thiazol-2-yl]amino]acetate.
| Compound Name | ethyl 2-oxo-2-[[4-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]-1,3-thiazol-2-yl]amino]acetate |
|---|---|
| PubChem CID | 13177563 |
| Molecular Formula | C15H12F3N3O4S |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | ethyl 2-oxo-2-[[4-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]-1,3-thiazol-2-yl]amino]acetate |
| SMILES | CCOC(=O)C(=O)Nc1nc(-c2ccc(NC(=O)C(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C15H12F3N3O4S/c1-2-25-12(23)11(22)21-14-20-10(7-26-14)8-3-5-9(6-4-8)19-13(24)15(16,17)18/h3-7H,2H2,1H3,(H,19,24)(H,20,21,22) |
| InChIKey | JNBFMPSYYDEPFL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|