C21H20N2O4S — CID 13037164
2-phenylpropyl 2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate (PubChem CID 13037164) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-phenylpropyl 2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate.
| Compound Name | 2-phenylpropyl 2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 13037164 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-phenylpropyl 2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate |
| SMILES | COc1ccc(-c2csc(NC(=O)C(=O)OCC(C)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H20N2O4S/c1-14(15-6-4-3-5-7-15)12-27-20(25)19(24)23-21-22-18(13-28-21)16-8-10-17(26-2)11-9-16/h3-11,13-14H,12H2,1-2H3,(H,22,23,24) |
| InChIKey | JOTPYWPDNJRRIT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|