C21H20N4O3S — CID 135442471
3-hydroxy-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-[(2-methylphenyl)diazenyl]but-2-enamide (PubChem CID 135442471) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 3-hydroxy-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-[(2-methylphenyl)diazenyl]but-2-enamide.
| Compound Name | 3-hydroxy-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-[(2-methylphenyl)diazenyl]but-2-enamide |
|---|---|
| PubChem CID | 135442471 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-hydroxy-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-[(2-methylphenyl)diazenyl]but-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)C(/N=N/c3ccccc3C)=C(C)O)n2)cc1 |
| InChI | InChI=1S/C21H20N4O3S/c1-13-6-4-5-7-17(13)24-25-19(14(2)26)20(27)23-21-22-18(12-29-21)15-8-10-16(28-3)11-9-15/h4-12,26H,1-3H3,(H,22,23,27)/b19-14?,25-24+ |
| InChIKey | DMNDZLRDQPSJOK-KRIXBPQJSA-N |
| XLogP | 5.64 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|