C25H20N4O2S — CID 135461343
(Z)-3-hydroxy-2-[(4-methylphenyl)diazenyl]-3-phenyl-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 135461343) has the molecular formula C25H20N4O2S and a molecular weight of 440.53 g/mol. Its IUPAC name is (Z)-3-hydroxy-2-[(4-methylphenyl)diazenyl]-3-phenyl-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-hydroxy-2-[(4-methylphenyl)diazenyl]-3-phenyl-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 135461343 |
| Molecular Formula | C25H20N4O2S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (Z)-3-hydroxy-2-[(4-methylphenyl)diazenyl]-3-phenyl-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(/N=N/C(C(=O)Nc2nc(-c3ccccc3)cs2)=C(\O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N4O2S/c1-17-12-14-20(15-13-17)28-29-22(23(30)19-10-6-3-7-11-19)24(31)27-25-26-21(16-32-25)18-8-4-2-5-9-18/h2-16,30H,1H3,(H,26,27,31)/b23-22-,29-28+ |
| InChIKey | TWPYEVNJEOGFFD-MZVBNREDSA-N |
| XLogP | 6.77 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|