C13H15N3O5S — CID 14814729
2-ethoxyethyl 2-[[4-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetate (PubChem CID 14814729) has the molecular formula C13H15N3O5S and a molecular weight of 325.35 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[[4-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetate.
| Compound Name | 2-ethoxyethyl 2-[[4-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 14814729 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-ethoxyethyl 2-[[4-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetate |
| SMILES | CCOCCOC(=O)C(=O)Nc1nc(-c2cc(C)on2)cs1 |
| InChI | InChI=1S/C13H15N3O5S/c1-3-19-4-5-20-12(18)11(17)15-13-14-10(7-22-13)9-6-8(2)21-16-9/h6-7H,3-5H2,1-2H3,(H,14,15,17) |
| InChIKey | MJDRXBYNDBEREB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|