C17H23N3O8 — CID 13277216
2-ethoxyethyl 2-[[6-[[2-(2-ethoxyethoxy)-2-oxoacetyl]amino]-2-pyridinyl]amino]-2-oxoacetate (PubChem CID 13277216) has the molecular formula C17H23N3O8 and a molecular weight of 397.38 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[[6-[[2-(2-ethoxyethoxy)-2-oxoacetyl]amino]-2-pyridinyl]amino]-2-oxoacetate.
| Compound Name | 2-ethoxyethyl 2-[[6-[[2-(2-ethoxyethoxy)-2-oxoacetyl]amino]-2-pyridinyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 13277216 |
| Molecular Formula | C17H23N3O8 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-ethoxyethyl 2-[[6-[[2-(2-ethoxyethoxy)-2-oxoacetyl]amino]-2-pyridinyl]amino]-2-oxoacetate |
| SMILES | CCOCCOC(=O)C(=O)Nc1cccc(NC(=O)C(=O)OCCOCC)n1 |
| InChI | InChI=1S/C17H23N3O8/c1-3-25-8-10-27-16(23)14(21)19-12-6-5-7-13(18-12)20-15(22)17(24)28-11-9-26-4-2/h5-7H,3-4,8-11H2,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | XWIUJKAVRYSJOM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 142.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|