C13H15N3O6S — CID 14814731
2-ethoxyethyl 2-[[4-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]amino]-2-oxoacetate (PubChem CID 14814731) has the molecular formula C13H15N3O6S and a molecular weight of 341.35 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[[4-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]amino]-2-oxoacetate.
| Compound Name | 2-ethoxyethyl 2-[[4-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 14814731 |
| Molecular Formula | C13H15N3O6S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2-ethoxyethyl 2-[[4-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]amino]-2-oxoacetate |
| SMILES | CCOCCOC(=O)C(=O)Nc1nc(-c2cc(CO)on2)cs1 |
| InChI | InChI=1S/C13H15N3O6S/c1-2-20-3-4-21-12(19)11(18)15-13-14-10(7-23-13)9-5-8(6-17)22-16-9/h5,7,17H,2-4,6H2,1H3,(H,14,15,18) |
| InChIKey | ZPSGPRIFKYQLDT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|