C17H14N2O4S2 — CID 155537147
acetyloxymethyl 4-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]benzoate (PubChem CID 155537147) has the molecular formula C17H14N2O4S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is acetyloxymethyl 4-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]benzoate.
| Compound Name | acetyloxymethyl 4-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 155537147 |
| Molecular Formula | C17H14N2O4S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | acetyloxymethyl 4-[(4-thiophen-3-yl-1,3-thiazol-2-yl)amino]benzoate |
| SMILES | CC(=O)OCOC(=O)c1ccc(Nc2nc(-c3ccsc3)cs2)cc1 |
| InChI | InChI=1S/C17H14N2O4S2/c1-11(20)22-10-23-16(21)12-2-4-14(5-3-12)18-17-19-15(9-25-17)13-6-7-24-8-13/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | JHHUZGULPKJASI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|