C19H29N7O7S — CID 88701061
2-(2-methoxyethyl)-1-[4-[5-[[(6E)-3-(methylamino)-2-nitro-5,8-dioxo-2H-1,4-dioxocin-3-yl]amino]pentyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 88701061) has the molecular formula C19H29N7O7S and a molecular weight of 499.55 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-1-[4-[5-[[(6E)-3-(methylamino)-2-nitro-5,8-dioxo-2H-1,4-dioxocin-3-yl]amino]pentyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-(2-methoxyethyl)-1-[4-[5-[[(6E)-3-(methylamino)-2-nitro-5,8-dioxo-2H-1,4-dioxocin-3-yl]amino]pentyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 88701061 |
| Molecular Formula | C19H29N7O7S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-(2-methoxyethyl)-1-[4-[5-[[(6E)-3-(methylamino)-2-nitro-5,8-dioxo-2H-1,4-dioxocin-3-yl]amino]pentyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | CNC1(NCCCCCc2csc(N/C(N)=N/CCOC)n2)OC(=O)/C=C\C(=O)OC1[N+](=O)[O-] |
| InChI | InChI=1S/C19H29N7O7S/c1-21-19(16(26(29)30)32-14(27)7-8-15(28)33-19)23-9-5-3-4-6-13-12-34-18(24-13)25-17(20)22-10-11-31-2/h7-8,12,16,21,23H,3-6,9-11H2,1-2H3,(H3,20,22,24,25)/b8-7- |
| InChIKey | DGVUEFXYADTTFY-FPLPWBNLSA-N |
| XLogP | -0.05 |
| TPSA | 192.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|