C10H17N7O3S — CID 13318022
2-[4-[3-[[(E)-1-(methylamino)-2-nitroethenyl]amino]oxypropyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 13318022) has the molecular formula C10H17N7O3S and a molecular weight of 315.36 g/mol. Its IUPAC name is 2-[4-[3-[[(E)-1-(methylamino)-2-nitroethenyl]amino]oxypropyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[3-[[(E)-1-(methylamino)-2-nitroethenyl]amino]oxypropyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 13318022 |
| Molecular Formula | C10H17N7O3S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[4-[3-[[(E)-1-(methylamino)-2-nitroethenyl]amino]oxypropyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | CN/C(=C\[N+](=O)[O-])NOCCCc1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C10H17N7O3S/c1-13-8(5-17(18)19)16-20-4-2-3-7-6-21-10(14-7)15-9(11)12/h5-6,13,16H,2-4H2,1H3,(H4,11,12,14,15)/b8-5+ |
| InChIKey | UVHNHQRPBZHKQW-VMPITWQZSA-N |
| XLogP | -0.20 |
| TPSA | 153.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|