C13H17ClN8O2S — CID 45265330
2-[4-[6-[[[(E)-1-(methylamino)-2-nitroethenyl]amino]methyl]-2-pyridinyl]-1,3-thiazol-2-yl]guanidine;hydrochloride (PubChem CID 45265330) has the molecular formula C13H17ClN8O2S and a molecular weight of 384.85 g/mol. Its IUPAC name is 2-[4-[6-[[[(E)-1-(methylamino)-2-nitroethenyl]amino]methyl]-2-pyridinyl]-1,3-thiazol-2-yl]guanidine;hydrochloride.
| Compound Name | 2-[4-[6-[[[(E)-1-(methylamino)-2-nitroethenyl]amino]methyl]-2-pyridinyl]-1,3-thiazol-2-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 45265330 |
| Molecular Formula | C13H17ClN8O2S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-[4-[6-[[[(E)-1-(methylamino)-2-nitroethenyl]amino]methyl]-2-pyridinyl]-1,3-thiazol-2-yl]guanidine;hydrochloride |
| SMILES | CN/C(=C\[N+](=O)[O-])NCc1cccc(-c2csc(N=C(N)N)n2)n1.Cl |
| InChI | InChI=1S/C13H16N8O2S.ClH/c1-16-11(6-21(22)23)17-5-8-3-2-4-9(18-8)10-7-24-13(19-10)20-12(14)15;/h2-4,6-7,16-17H,5H2,1H3,(H4,14,15,19,20);1H/b11-6+; |
| InChIKey | GRHVJFKZPBZFNC-ICSBZGNSSA-N |
| XLogP | 0.92 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|