C12H11F3N6OS — CID 10382866
N-[[6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 10382866) has the molecular formula C12H11F3N6OS and a molecular weight of 344.32 g/mol. Its IUPAC name is N-[[6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 10382866 |
| Molecular Formula | C12H11F3N6OS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[[6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | NC(N)=Nc1nc(-c2cccc(CNC(=O)C(F)(F)F)n2)cs1 |
| InChI | InChI=1S/C12H11F3N6OS/c13-12(14,15)9(22)18-4-6-2-1-3-7(19-6)8-5-23-11(20-8)21-10(16)17/h1-3,5H,4H2,(H,18,22)(H4,16,17,20,21) |
| InChIKey | LJVYERKBHNOXLN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|