C13H15N5O2S — CID 19439677
methyl N-[[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methyl]carbamate (PubChem CID 19439677) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is methyl N-[[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methyl]carbamate.
| Compound Name | methyl N-[[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 19439677 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | methyl N-[[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methyl]carbamate |
| SMILES | COC(=O)NCc1cccc(-c2csc(N=C(N)N)n2)c1 |
| InChI | InChI=1S/C13H15N5O2S/c1-20-13(19)16-6-8-3-2-4-9(5-8)10-7-21-12(17-10)18-11(14)15/h2-5,7H,6H2,1H3,(H,16,19)(H4,14,15,17,18) |
| InChIKey | XYWDVRKGWCQWBH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|