C11H12N6S — CID 88671972
N'-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methanimidamide (PubChem CID 88671972) has the molecular formula C11H12N6S and a molecular weight of 260.33 g/mol. Its IUPAC name is N'-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methanimidamide.
| Compound Name | N'-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methanimidamide |
|---|---|
| PubChem CID | 88671972 |
| Molecular Formula | C11H12N6S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N'-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methanimidamide |
| SMILES | N/C=N/c1cccc(-c2csc(N=C(N)N)n2)c1 |
| InChI | InChI=1S/C11H12N6S/c12-6-15-8-3-1-2-7(4-8)9-5-18-11(16-9)17-10(13)14/h1-6H,(H2,12,15)(H4,13,14,16,17) |
| InChIKey | ZUUPCKUOYLOUTH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|