C10H11N5OS — CID 10264073
2-[4-[2-(hydroxymethyl)-4-pyridinyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 10264073) has the molecular formula C10H11N5OS and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-[4-[2-(hydroxymethyl)-4-pyridinyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[2-(hydroxymethyl)-4-pyridinyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 10264073 |
| Molecular Formula | C10H11N5OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-[4-[2-(hydroxymethyl)-4-pyridinyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(-c2ccnc(CO)c2)cs1 |
| InChI | InChI=1S/C10H11N5OS/c11-9(12)15-10-14-8(5-17-10)6-1-2-13-7(3-6)4-16/h1-3,5,16H,4H2,(H4,11,12,14,15) |
| InChIKey | VJODNSVLFYBLSS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|