C8H8N4OS — CID 13387169
2-[4-(furan-2-yl)-1,3-thiazol-2-yl]guanidine (PubChem CID 13387169) has the molecular formula C8H8N4OS and a molecular weight of 208.25 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-(furan-2-yl)-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 13387169 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2-[4-(furan-2-yl)-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(-c2ccco2)cs1 |
| InChI | InChI=1S/C8H8N4OS/c9-7(10)12-8-11-5(4-14-8)6-2-1-3-13-6/h1-4H,(H4,9,10,11,12) |
| InChIKey | WVJWYTSIHKZPBU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|