C7H9Br2N5S2 — CID 23321326
2-[4-(1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide (PubChem CID 23321326) has the molecular formula C7H9Br2N5S2 and a molecular weight of 387.13 g/mol. Its IUPAC name is 2-[4-(1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide.
| Compound Name | 2-[4-(1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide |
|---|---|
| PubChem CID | 23321326 |
| Molecular Formula | C7H9Br2N5S2 |
| Molecular Weight | 387.13 g/mol |
| Exact Mass | 384.87 |
| IUPAC Name | 2-[4-(1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide |
| SMILES | Br.Br.NC(N)=Nc1nc(-c2cscn2)cs1 |
| InChI | InChI=1S/C7H7N5S2.2BrH/c8-6(9)12-7-11-5(2-14-7)4-1-13-3-10-4;;/h1-3H,(H4,8,9,11,12);2*1H |
| InChIKey | HQJOVVJTCQROAG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.13 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|