C14H18N4S — CID 24938739
2-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]guanidine (PubChem CID 24938739) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 24938739 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]guanidine |
| SMILES | CC(C)(C)c1ccc(-c2csc(N=C(N)N)n2)cc1 |
| InChI | InChI=1S/C14H18N4S/c1-14(2,3)10-6-4-9(5-7-10)11-8-19-13(17-11)18-12(15)16/h4-8H,1-3H3,(H4,15,16,17,18) |
| InChIKey | FFRFUKHAHYFSTQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|