C10H10Cl2N4S — CID 24854747
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride (PubChem CID 24854747) has the molecular formula C10H10Cl2N4S and a molecular weight of 289.19 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride.
| Compound Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 24854747 |
| Molecular Formula | C10H10Cl2N4S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C10H9ClN4S.ClH/c11-7-3-1-6(2-4-7)8-5-16-10(14-8)15-9(12)13;/h1-5H,(H4,12,13,14,15);1H |
| InChIKey | SMFFUGYAYNJBIF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|