C11H14Cl2N6OS — CID 18953842
6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-5-methylpyridine-2-carboxamide;dihydrochloride (PubChem CID 18953842) has the molecular formula C11H14Cl2N6OS and a molecular weight of 349.25 g/mol. Its IUPAC name is 6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-5-methylpyridine-2-carboxamide;dihydrochloride.
| Compound Name | 6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-5-methylpyridine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 18953842 |
| Molecular Formula | C11H14Cl2N6OS |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-5-methylpyridine-2-carboxamide;dihydrochloride |
| SMILES | Cc1ccc(C(N)=O)nc1-c1csc(N=C(N)N)n1.Cl.Cl |
| InChI | InChI=1S/C11H12N6OS.2ClH/c1-5-2-3-6(9(12)18)15-8(5)7-4-19-11(16-7)17-10(13)14;;/h2-4H,1H3,(H2,12,18)(H4,13,14,16,17);2*1H |
| InChIKey | UCRZHAMEEAHHQJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|