C8H11Cl2N3O2 — CID 175165301
3-methylpyridine-2,6-dicarboxamide;dihydrochloride (PubChem CID 175165301) has the molecular formula C8H11Cl2N3O2 and a molecular weight of 252.10 g/mol. Its IUPAC name is 3-methylpyridine-2,6-dicarboxamide;dihydrochloride.
| Compound Name | 3-methylpyridine-2,6-dicarboxamide;dihydrochloride |
|---|---|
| PubChem CID | 175165301 |
| Molecular Formula | C8H11Cl2N3O2 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 3-methylpyridine-2,6-dicarboxamide;dihydrochloride |
| SMILES | Cc1ccc(C(N)=O)nc1C(N)=O.Cl.Cl |
| InChI | InChI=1S/C8H9N3O2.2ClH/c1-4-2-3-5(7(9)12)11-6(4)8(10)13;;/h2-3H,1H3,(H2,9,12)(H2,10,13);2*1H |
| InChIKey | BMCGKLQVGGFYIW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |