C16H17N3O3 — CID 170589414
3-amino-4-(3-hydroxy-2,6-dimethylphenyl)-6-(1-hydroxyethenyl)pyridine-2-carboxamide (PubChem CID 170589414) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-amino-4-(3-hydroxy-2,6-dimethylphenyl)-6-(1-hydroxyethenyl)pyridine-2-carboxamide.
| Compound Name | 3-amino-4-(3-hydroxy-2,6-dimethylphenyl)-6-(1-hydroxyethenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170589414 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-amino-4-(3-hydroxy-2,6-dimethylphenyl)-6-(1-hydroxyethenyl)pyridine-2-carboxamide |
| SMILES | C=C(O)c1cc(-c2c(C)ccc(O)c2C)c(N)c(C(N)=O)n1 |
| InChI | InChI=1S/C16H17N3O3/c1-7-4-5-12(21)8(2)13(7)10-6-11(9(3)20)19-15(14(10)17)16(18)22/h4-6,20-21H,3,17H2,1-2H3,(H2,18,22) |
| InChIKey | FBMGUYJUUXKYEZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|