C17H16N2O2S — CID 177042849
5-amino-6-(3-hydroxy-2,6-dimethylphenyl)-1-benzothiophene-4-carboxamide (PubChem CID 177042849) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 5-amino-6-(3-hydroxy-2,6-dimethylphenyl)-1-benzothiophene-4-carboxamide.
| Compound Name | 5-amino-6-(3-hydroxy-2,6-dimethylphenyl)-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 177042849 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 5-amino-6-(3-hydroxy-2,6-dimethylphenyl)-1-benzothiophene-4-carboxamide |
| SMILES | Cc1ccc(O)c(C)c1-c1cc2sccc2c(C(N)=O)c1N |
| InChI | InChI=1S/C17H16N2O2S/c1-8-3-4-12(20)9(2)14(8)11-7-13-10(5-6-22-13)15(16(11)18)17(19)21/h3-7,20H,18H2,1-2H3,(H2,19,21) |
| InChIKey | RPFAWSXZISTDHU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|