C19H18N4O2 — CID 177283680
2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridazin-4-ylbenzamide (PubChem CID 177283680) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridazin-4-ylbenzamide.
| Compound Name | 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridazin-4-ylbenzamide |
|---|---|
| PubChem CID | 177283680 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridazin-4-ylbenzamide |
| SMILES | Cc1ccc(O)c(C)c1-c1cc(-c2ccnnc2)cc(C(N)=O)c1N |
| InChI | InChI=1S/C19H18N4O2/c1-10-3-4-16(24)11(2)17(10)14-7-13(12-5-6-22-23-9-12)8-15(18(14)20)19(21)25/h3-9,24H,20H2,1-2H3,(H2,21,25) |
| InChIKey | AQXHXCFTNXMKBY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|