C17H17N3O2 — CID 177042909
6-amino-7-(3-hydroxy-2,6-dimethylphenyl)indolizine-5-carboxamide (PubChem CID 177042909) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 6-amino-7-(3-hydroxy-2,6-dimethylphenyl)indolizine-5-carboxamide.
| Compound Name | 6-amino-7-(3-hydroxy-2,6-dimethylphenyl)indolizine-5-carboxamide |
|---|---|
| PubChem CID | 177042909 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 6-amino-7-(3-hydroxy-2,6-dimethylphenyl)indolizine-5-carboxamide |
| SMILES | Cc1ccc(O)c(C)c1-c1cc2cccn2c(C(N)=O)c1N |
| InChI | InChI=1S/C17H17N3O2/c1-9-5-6-13(21)10(2)14(9)12-8-11-4-3-7-20(11)16(15(12)18)17(19)22/h3-8,21H,18H2,1-2H3,(H2,19,22) |
| InChIKey | CUJLJERFPBUNCU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |