C11H15Cl2N7OS — CID 18953932
[6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]methylurea;dihydrochloride (PubChem CID 18953932) has the molecular formula C11H15Cl2N7OS and a molecular weight of 364.26 g/mol. Its IUPAC name is [6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]methylurea;dihydrochloride.
| Compound Name | [6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]methylurea;dihydrochloride |
|---|---|
| PubChem CID | 18953932 |
| Molecular Formula | C11H15Cl2N7OS |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | [6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]methylurea;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)NCc1cccc(-c2csc(N=C(N)N)n2)n1 |
| InChI | InChI=1S/C11H13N7OS.2ClH/c12-9(13)18-11-17-8(5-20-11)7-3-1-2-6(16-7)4-15-10(14)19;;/h1-3,5H,4H2,(H3,14,15,19)(H4,12,13,17,18);2*1H |
| InChIKey | XYUZOXORVNLIKF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|