C12H16Cl2N6OS — CID 18953876
N-[[2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-4-pyridinyl]methyl]acetamide;dihydrochloride (PubChem CID 18953876) has the molecular formula C12H16Cl2N6OS and a molecular weight of 363.27 g/mol. Its IUPAC name is N-[[2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-4-pyridinyl]methyl]acetamide;dihydrochloride.
| Compound Name | N-[[2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-4-pyridinyl]methyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 18953876 |
| Molecular Formula | C12H16Cl2N6OS |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-[[2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-4-pyridinyl]methyl]acetamide;dihydrochloride |
| SMILES | CC(=O)NCc1ccnc(-c2csc(N=C(N)N)n2)c1.Cl.Cl |
| InChI | InChI=1S/C12H14N6OS.2ClH/c1-7(19)16-5-8-2-3-15-9(4-8)10-6-20-12(17-10)18-11(13)14;;/h2-4,6H,5H2,1H3,(H,16,19)(H4,13,14,17,18);2*1H |
| InChIKey | AYCBMFXBWDEBLF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|