C12H15IN4O2S2 — CID 67807358
methyl N'-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]carbamimidothioate;hydroiodide (PubChem CID 67807358) has the molecular formula C12H15IN4O2S2 and a molecular weight of 438.32 g/mol. Its IUPAC name is methyl N'-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 67807358 |
| Molecular Formula | C12H15IN4O2S2 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | methyl N'-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]carbamimidothioate;hydroiodide |
| SMILES | CSC(N)=Nc1nc(-c2ccc(CNC(C)=O)o2)cs1.I |
| InChI | InChI=1S/C12H14N4O2S2.HI/c1-7(17)14-5-8-3-4-10(18-8)9-6-20-12(15-9)16-11(13)19-2;/h3-4,6H,5H2,1-2H3,(H,14,17)(H2,13,15,16);1H |
| InChIKey | YOWJDHYFBIQAJB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|