C17H16N2O2S — CID 32618019
N-[[5-(2-benzyl-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide (PubChem CID 32618019) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-[[5-(2-benzyl-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide.
| Compound Name | N-[[5-(2-benzyl-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 32618019 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[[5-(2-benzyl-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(Cc3ccccc3)n2)o1 |
| InChI | InChI=1S/C17H16N2O2S/c1-12(20)18-10-14-7-8-16(21-14)15-11-22-17(19-15)9-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,18,20) |
| InChIKey | SISDYHKWUQIDQK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |