C23H19N3O4S — CID 24570801
N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-4-phenoxybenzamide (PubChem CID 24570801) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-4-phenoxybenzamide.
| Compound Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 24570801 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-4-phenoxybenzamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)c3ccc(Oc4ccccc4)cc3)n2)o1 |
| InChI | InChI=1S/C23H19N3O4S/c1-15(27)24-13-19-11-12-21(30-19)20-14-31-23(25-20)26-22(28)16-7-9-18(10-8-16)29-17-5-3-2-4-6-17/h2-12,14H,13H2,1H3,(H,24,27)(H,25,26,28) |
| InChIKey | ZVPSWRAHQCJYDK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |