C24H21N3O4S — CID 24570707
N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-3-phenylmethoxybenzamide (PubChem CID 24570707) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-3-phenylmethoxybenzamide.
| Compound Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 24570707 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-3-phenylmethoxybenzamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)c3cccc(OCc4ccccc4)c3)n2)o1 |
| InChI | InChI=1S/C24H21N3O4S/c1-16(28)25-13-20-10-11-22(31-20)21-15-32-24(26-21)27-23(29)18-8-5-9-19(12-18)30-14-17-6-3-2-4-7-17/h2-12,15H,13-14H2,1H3,(H,25,28)(H,26,27,29) |
| InChIKey | YOMDIJQDRZLYKJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |