C18H19N5O3S — CID 67808925
N-[[5-[2-[[amino-(4-methoxyanilino)methylidene]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide (PubChem CID 67808925) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[[5-[2-[[amino-(4-methoxyanilino)methylidene]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-[[amino-(4-methoxyanilino)methylidene]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 67808925 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[[5-[2-[[amino-(4-methoxyanilino)methylidene]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide |
| SMILES | COc1ccc(NC(N)=Nc2nc(-c3ccc(CNC(C)=O)o3)cs2)cc1 |
| InChI | InChI=1S/C18H19N5O3S/c1-11(24)20-9-14-7-8-16(26-14)15-10-27-18(22-15)23-17(19)21-12-3-5-13(25-2)6-4-12/h3-8,10H,9H2,1-2H3,(H,20,24)(H3,19,21,22,23) |
| InChIKey | YHAMWDDCJLYYPO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|