C11H16N6O3S2 — CID 15704152
2-[4-[5-[(dimethylsulfamoylamino)methyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine (PubChem CID 15704152) has the molecular formula C11H16N6O3S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-[4-[5-[(dimethylsulfamoylamino)methyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[5-[(dimethylsulfamoylamino)methyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 15704152 |
| Molecular Formula | C11H16N6O3S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-[4-[5-[(dimethylsulfamoylamino)methyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine |
| SMILES | CN(C)S(=O)(=O)NCc1ccc(-c2csc(N=C(N)N)n2)o1 |
| InChI | InChI=1S/C11H16N6O3S2/c1-17(2)22(18,19)14-5-7-3-4-9(20-7)8-6-21-11(15-8)16-10(12)13/h3-4,6,14H,5H2,1-2H3,(H4,12,13,15,16) |
| InChIKey | XPJBSAJMFYKYPN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|