C18H20N6O3S3 — CID 10322215
methyl N'-[[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]furan-2-yl]methyl]-N-(4-methylphenyl)sulfonylcarbamimidothioate (PubChem CID 10322215) has the molecular formula C18H20N6O3S3 and a molecular weight of 464.60 g/mol. Its IUPAC name is methyl N'-[[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]furan-2-yl]methyl]-N-(4-methylphenyl)sulfonylcarbamimidothioate.
| Compound Name | methyl N'-[[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]furan-2-yl]methyl]-N-(4-methylphenyl)sulfonylcarbamimidothioate |
|---|---|
| PubChem CID | 10322215 |
| Molecular Formula | C18H20N6O3S3 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | methyl N'-[[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]furan-2-yl]methyl]-N-(4-methylphenyl)sulfonylcarbamimidothioate |
| SMILES | CS/C(=N\Cc1ccc(-c2csc(N=C(N)N)n2)o1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20N6O3S3/c1-11-3-6-13(7-4-11)30(25,26)24-17(28-2)21-9-12-5-8-15(27-12)14-10-29-18(22-14)23-16(19)20/h3-8,10H,9H2,1-2H3,(H,21,24)(H4,19,20,22,23) |
| InChIKey | HNSICMPXTFZMDW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|