C12H14N2O2S2 — CID 134123429
methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate (PubChem CID 134123429) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate.
| Compound Name | methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate |
|---|---|
| PubChem CID | 134123429 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate |
| SMILES | C#CC/N=C(/NS(=O)(=O)c1ccc(C)cc1)SC |
| InChI | InChI=1S/C12H14N2O2S2/c1-4-9-13-12(17-3)14-18(15,16)11-7-5-10(2)6-8-11/h1,5-8H,9H2,2-3H3,(H,13,14) |
| InChIKey | UPWKVYRFDWEPCR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|