About methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate
methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate (PubChem CID 134123429) has the molecular formula C12H14N2O2S2
and a molecular weight of 282.39 g/mol. Its IUPAC name is methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate |
| PubChem CID | 134123429 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate |
| SMILES | C#CC/N=C(/NS(=O)(=O)c1ccc(C)cc1)SC |
| InChI | InChI=1S/C12H14N2O2S2/c1-4-9-13-12(17-3)14-18(15,16)11-7-5-10(2)6-8-11/h1,5-8H,9H2,2-3H3,(H,13,14) |
| InChIKey | UPWKVYRFDWEPCR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate?
The IUPAC name of methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate (CID 134123429) is methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate.
What is the SMILES notation for methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate?
The canonical SMILES for methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate is C#CC/N=C(/NS(=O)(=O)c1ccc(C)cc1)SC.
What is the InChIKey of methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate?
The InChIKey is UPWKVYRFDWEPCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2S2/c1-4-9-13-12(17-3)14-18(15,16)11-7-5-10(2)6-8-11/h1,5-8H,9H2,2-3H3,(H,13,14).
What are the key properties of methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate?
methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate has a molecular weight of 282.39 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(4-methylphenyl)sulfonyl-N'-prop-2-ynylcarbamimidothioate is sourced from PubChem (CID 134123429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).