C19H27N3O3S3 — CID 134132168
methyl N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-N-(4-methylphenyl)sulfonylcarbamimidothioate (PubChem CID 134132168) has the molecular formula C19H27N3O3S3 and a molecular weight of 441.64 g/mol. Its IUPAC name is methyl N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-N-(4-methylphenyl)sulfonylcarbamimidothioate.
| Compound Name | methyl N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-N-(4-methylphenyl)sulfonylcarbamimidothioate |
|---|---|
| PubChem CID | 134132168 |
| Molecular Formula | C19H27N3O3S3 |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | methyl N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-N-(4-methylphenyl)sulfonylcarbamimidothioate |
| SMILES | CS/C(=N\CCSCc1ccc(CN(C)C)o1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H27N3O3S3/c1-15-5-9-18(10-6-15)28(23,24)21-19(26-4)20-11-12-27-14-17-8-7-16(25-17)13-22(2)3/h5-10H,11-14H2,1-4H3,(H,20,21) |
| InChIKey | VAFHYMWCORIRPP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|